CAS 879410-94-3 is the registry number for N-Phenyl-5-chloro-1,2-dihydro-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxamide. Offered by: TRC. Available pack sizes: 500mg.
5-chloro-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (CAS 879410-94-3) is a chemical compound with the molecular formula C17H13ClN2O3 and a molecular weight of 328.7 g/mol. IUPAC name: 5-chloro-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide. InChIKey: BZKCTVZVKAXVFH-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O3 |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | 5-chloro-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| InChIKey | BZKCTVZVKAXVFH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC=C2)Cl)C(=C(C1=O)C(=O)NC3=CC=CC=C3)O |
Computed by PubChem (NCBI)