CAS 2172879-52-4 appears in our catalog under these names: LIT-927, 98%, LIT927/ 99.73% (existing batch purity), LIT–927 , LIT-927, 99.86%. Offered by: AmBeed, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 250mg, 10mg, 100mg, 25mg, 5mg, 1g, 50mg, 2mg.
6-(4-chlorophenyl)-4-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one (CAS 2172879-52-4) is a chemical compound with the molecular formula C17H13ClN2O3 and a molecular weight of 328.7 g/mol. IUPAC name: 6-(4-chlorophenyl)-4-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one. InChIKey: BYYRNPIGDRRGLJ-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O3 |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-4-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one |
| InChIKey | BYYRNPIGDRRGLJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NC(=O)NC(=C2)C3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)