CAS 18268-68-3 appears in our catalog under these names: 3–Chloro–4,5–dimethoxybenzaldehyde, 3-Chloro-4,5-dimethoxybenzaldehyde, 3-Chloro-4,5-dimethoxybenzaldehyde 95%, 3-Chloro-4,5-dimethoxybenzaldehyde, 98%, 3-Chloro-4,5-dimethoxybenzaldehyde, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 500mg, 2.5g, 100mg.
3-chloro-4,5-dimethoxybenzaldehyde (CAS 18268-68-3) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 3-chloro-4,5-dimethoxybenzaldehyde. InChIKey: AMZCHEDPEAQEMC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-chloro-4,5-dimethoxybenzaldehyde |
| InChIKey | AMZCHEDPEAQEMC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Cl)OC |
Computed by PubChem (NCBI)