CAS 1831751-97-3 appears in our catalog under these names: 1-((4-Fluorophenyl)methyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%, 1-((4-Fluorophenyl)methyl)pyrrolidine-3-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-[(4-fluorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1831751-97-3) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: HNAYIEGFXXMSST-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | HNAYIEGFXXMSST-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)CC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)