CAS 183613-11-8 is the registry number for Carbostyril 124 N-Carboxymethyl Chloride. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
2-chloro-N-(4-methyl-2-oxo-1H-quinolin-7-yl)acetamide (CAS 183613-11-8) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 2-chloro-N-(4-methyl-2-oxo-1H-quinolin-7-yl)acetamide. InChIKey: USRUAYVEQRYSTQ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 2-chloro-N-(4-methyl-2-oxo-1H-quinolin-7-yl)acetamide |
| InChIKey | USRUAYVEQRYSTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C=CC(=C2)NC(=O)CCl |
Computed by PubChem (NCBI)