Products 183666-47-9
CAS 183666-47-9 appears in our catalog under these names: 4-(4-Methoxyphenyl)-1,2-oxazol-5-amine, 4-(4-Methoxyphenyl)isoxazol-5-amine, 97%, 4-(4-Methoxyphenyl)-1,2-oxazol-5-amine, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
4-(4-methoxyphenyl)-1,2-oxazol-5-amine (CAS 183666-47-9) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 4-(4-methoxyphenyl)-1,2-oxazol-5-amine. InChIKey: IDNIKDCAFQCCIS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-1,2-oxazol-5-amine |
| InChIKey | IDNIKDCAFQCCIS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(ON=C2)N |
Computed by PubChem (NCBI)