CAS 184041-27-8 is the registry number for 3-((4-Bromophenyl)amino)-2,2-dimethyl-3-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromoanilino)-2,2-dimethyl-3-oxopropanoic acid (CAS 184041-27-8) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: 3-(4-bromoanilino)-2,2-dimethyl-3-oxopropanoic acid. InChIKey: PRZMSLAFCVTVOK-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | 3-(4-bromoanilino)-2,2-dimethyl-3-oxopropanoic acid |
| InChIKey | PRZMSLAFCVTVOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)