Products 18455-27-1
CAS 18455-27-1 is the registry number for Rubreserine. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-6,7-dione (CAS 18455-27-1) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: (3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-6,7-dione. InChIKey: HOQNKCYZDSDWJL-OLZOCXBDSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-6,7-dione |
| InChIKey | HOQNKCYZDSDWJL-OLZOCXBDSA-N |
| SMILES | C[C@@]12CCN([C@@H]1N(C3=CC(=O)C(=O)C=C23)C)C |
Computed by PubChem (NCBI)