Products 1845754-40-6
CAS 1845754-40-6 appears in our catalog under these names: 6-BROMO-2,8-DIMETHYLIMIDAZO[1,2-A]PYRAZINE, 98%, 6-Bromo-2,8-dimethylimidazo[1,2-a]pyrazine, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
6-bromo-2,8-dimethylimidazo[1,2-a]pyrazine (CAS 1845754-40-6) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-2,8-dimethylimidazo[1,2-a]pyrazine. InChIKey: ZUULQOKAEUOVEU-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-2,8-dimethylimidazo[1,2-a]pyrazine |
| InChIKey | ZUULQOKAEUOVEU-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C(C2=N1)C)Br |
Computed by PubChem (NCBI)