CAS 184763-33-5 appears in our catalog under these names: 4-(4-Methyl-2,5-dioxoimidazolidin-4-yl)benzoic acid, 95%, 4-(4-Methyl-2,5-dioxoimidazolidin-4-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoic acid (CAS 184763-33-5) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoic acid. InChIKey: GQOVIFKCRUPMQR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoic acid |
| InChIKey | GQOVIFKCRUPMQR-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)