CAS 1849-25-8 appears in our catalog under these names: 4-(Phenylethynyl)aniline, 4-(Phenylethynyl)aniline 95%, 4-(Phenylethynyl)aniline, 96%, 96%, 4-(Phenylethynyl)aniline, 96%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 250mg, 1g, 5g, 100mg, 10g.
4-(2-phenylethynyl)aniline (CAS 1849-25-8) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 4-(2-phenylethynyl)aniline. InChIKey: ODFQRHOQXHVJTQ-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-(2-phenylethynyl)aniline |
| InChIKey | ODFQRHOQXHVJTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)