CAS 1850111-02-2 is the registry number for 3-Amino-1-(1,1-dioxidothietan-3-yl)azetidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-1-(1,1-dioxothietan-3-yl)azetidin-2-one (CAS 1850111-02-2) is a chemical compound with the molecular formula C6H10N2O3S and a molecular weight of 190.22 g/mol. IUPAC name: 3-amino-1-(1,1-dioxothietan-3-yl)azetidin-2-one. InChIKey: OKOFNBWDNYRVPH-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O3S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 3-amino-1-(1,1-dioxothietan-3-yl)azetidin-2-one |
| InChIKey | OKOFNBWDNYRVPH-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N1C2CS(=O)(=O)C2)N |
Computed by PubChem (NCBI)