CAS 2381895-87-8 is the registry number for N-((4R)-4-Thiazolidinylcarbonyl)glycine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg.
2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]acetic acid (CAS 2381895-87-8) is a chemical compound with the molecular formula C6H10N2O3S and a molecular weight of 190.22 g/mol. IUPAC name: 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]acetic acid. InChIKey: NXTYBQWVXDPCKQ-BYPYZUCNSA-N.
| Molecular formula | C6H10N2O3S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]acetic acid |
| InChIKey | NXTYBQWVXDPCKQ-BYPYZUCNSA-N |
| SMILES | C1[C@H](NCS1)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)