CAS 201207-66-1 appears in our catalog under these names: 1,3,5-Trimethyl-1h-pyrazole-4-sulfonic acid, 95%, 1,3,5-Trimethyl-1H-pyrazole-4-sulfonic acid, 97%, 1,3,5–trimethyl–1H–pyrazole–4–sulfonic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g.
1,3,5-trimethylpyrazole-4-sulfonic acid (CAS 201207-66-1) is a chemical compound with the molecular formula C6H10N2O3S and a molecular weight of 190.22 g/mol. IUPAC name: 1,3,5-trimethylpyrazole-4-sulfonic acid. InChIKey: PPZFWLBZGQWMEP-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O3S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 1,3,5-trimethylpyrazole-4-sulfonic acid |
| InChIKey | PPZFWLBZGQWMEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)S(=O)(=O)O |
Computed by PubChem (NCBI)