CAS 2408963-47-1 is the registry number for 2-(Azetidin-3-ylidene)acetonitrile methanesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(azetidin-3-ylidene)acetonitrile;methanesulfonic acid (CAS 2408963-47-1) is a chemical compound with the molecular formula C6H10N2O3S and a molecular weight of 190.22 g/mol. IUPAC name: 2-(azetidin-3-ylidene)acetonitrile;methanesulfonic acid. InChIKey: MVQKKVBJZJLIHU-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O3S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 2-(azetidin-3-ylidene)acetonitrile;methanesulfonic acid |
| InChIKey | MVQKKVBJZJLIHU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1C(=CC#N)CN1 |
Computed by PubChem (NCBI)