CAS 2138069-13-1 is the registry number for 3a-Methyl-hexahydro-1λâ¶-imidazo(1,5-b)(1,2)thiazole-1,1,6-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3a-methyl-1,1-dioxo-2,3,4,5-tetrahydroimidazo[1,5-b][1,2]thiazol-6-one (CAS 2138069-13-1) is a chemical compound with the molecular formula C6H10N2O3S and a molecular weight of 190.22 g/mol. IUPAC name: 3a-methyl-1,1-dioxo-2,3,4,5-tetrahydroimidazo[1,5-b][1,2]thiazol-6-one. InChIKey: JHWZSGVFXWAKLU-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O3S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 3a-methyl-1,1-dioxo-2,3,4,5-tetrahydroimidazo[1,5-b][1,2]thiazol-6-one |
| InChIKey | JHWZSGVFXWAKLU-UHFFFAOYSA-N |
| SMILES | CC12CCS(=O)(=O)N1C(=O)NC2 |
Computed by PubChem (NCBI)