Products 18508-77-5
CAS 18508-77-5 is the registry number for Illudalic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,6-dihydroxy-8,8-dimethyl-1-oxo-3,4,7,9-tetrahydrocyclopenta[h]isochromene-5-carbaldehyde (CAS 18508-77-5) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 3,6-dihydroxy-8,8-dimethyl-1-oxo-3,4,7,9-tetrahydrocyclopenta[h]isochromene-5-carbaldehyde. InChIKey: BDEDPKFUFGCVCJ-UHFFFAOYSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | 3,6-dihydroxy-8,8-dimethyl-1-oxo-3,4,7,9-tetrahydrocyclopenta[h]isochromene-5-carbaldehyde |
| InChIKey | BDEDPKFUFGCVCJ-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C3C(=C(C(=C2C1)O)C=O)CC(OC3=O)O)C |
Computed by PubChem (NCBI)