CAS 1851034-75-7 appears in our catalog under these names: 2-(Azetidin-1-yl)-3-nitropyridine, 95%, 2-(Azetidin-1-yl)-3-nitropyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(azetidin-1-yl)-3-nitropyridine (CAS 1851034-75-7) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 2-(azetidin-1-yl)-3-nitropyridine. InChIKey: UNRDPHNKZYOTQU-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 2-(azetidin-1-yl)-3-nitropyridine |
| InChIKey | UNRDPHNKZYOTQU-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)