Products 185154-95-4
CAS 185154-95-4 is the registry number for 2-Acetoxyacorenone. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,3R,4S,5S)-1,8-dimethyl-9-oxo-4-propan-2-ylspiro[4.5]dec-7-en-3-yl] acetate (CAS 185154-95-4) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: [(1S,3R,4S,5S)-1,8-dimethyl-9-oxo-4-propan-2-ylspiro[4.5]dec-7-en-3-yl] acetate. InChIKey: LDEHIZSFHFOEKN-DXEWXGHRSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | [(1S,3R,4S,5S)-1,8-dimethyl-9-oxo-4-propan-2-ylspiro[4.5]dec-7-en-3-yl] acetate |
| InChIKey | LDEHIZSFHFOEKN-DXEWXGHRSA-N |
| SMILES | C[C@H]1C[C@H]([C@H]([C@]12CC=C(C(=O)C2)C)C(C)C)OC(=O)C |
Computed by PubChem (NCBI)