CAS 185312-82-7 appears in our catalog under these names: Methyl 4–Bromo–2–chlorobenzoate, Methyl 4-Bromo-2-chlorobenzoate, >98.0%(GC), Methyl 4-Bromo-2-chlorobenzoate, 98%, 98%, Methyl 4-bromo-2-chlorobenzoate, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100g.
Methyl 4-bromo-2-chlorobenzoate (CAS 185312-82-7) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 4-bromo-2-chlorobenzoate. InChIKey: JSNXIWYWUKTWAX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 4-bromo-2-chlorobenzoate |
| InChIKey | JSNXIWYWUKTWAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)