Products 185522-92-3
CAS 185522-92-3 is the registry number for Xanthine oxidase-IN-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(2,4-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 185522-92-3) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (E)-1-(2,4-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: ATHWOBRNXTYZEM-BJMVGYQFSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (E)-1-(2,4-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | ATHWOBRNXTYZEM-BJMVGYQFSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)