CAS 185526-10-7 appears in our catalog under these names: (2S)-4-(4-Hydroxyphenyl)-2-((2-methylpropan-2-yl)oxycarbonylamino)butanoic acid, Boc-D-HoTyr-OH 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-4-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 185526-10-7) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: (2R)-4-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: CDPGKTTZDRPESV-GFCCVEGCSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | (2R)-4-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | CDPGKTTZDRPESV-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)