Products 1858249-69-0

CAS 1858249-69-0 is the registry number for 4-(5-Isopropyl-1,2,4-oxadiazol-3-yl)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)benzoyl chloride (CAS 1858249-69-0) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)benzoyl chloride. InChIKey: JJBKMAOORTXWJN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11ClN2O2
Molecular weight250.68 g/mol
IUPAC name4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)benzoyl chloride
InChIKeyJJBKMAOORTXWJN-UHFFFAOYSA-N
SMILESCC(C)C1=NC(=NO1)C2=CC=C(C=C2)C(=O)Cl

Computed by PubChem (NCBI)