CAS 1862910-90-4 is the registry number for N,N-dimethyl-3-(trifluoromethyl)pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N,N-dimethyl-3-(trifluoromethyl)pyridin-2-amine (CAS 1862910-90-4) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: N,N-dimethyl-3-(trifluoromethyl)pyridin-2-amine. InChIKey: DXWHWLJRIBPLMR-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | N,N-dimethyl-3-(trifluoromethyl)pyridin-2-amine |
| InChIKey | DXWHWLJRIBPLMR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC=N1)C(F)(F)F |
Computed by PubChem (NCBI)