CAS 186348-58-3 is the registry number for 2-((2R)-2,3-Dihydroxypropyl)-1H-isoindole-1,3(2H)-dione. Offered by: TRC. Available pack sizes: 250mg.
2-[(2R)-2,3-dihydroxypropyl]isoindole-1,3-dione (CAS 186348-58-3) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 2-[(2R)-2,3-dihydroxypropyl]isoindole-1,3-dione. InChIKey: GUUVCKWUQHAMTB-SSDOTTSWSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-[(2R)-2,3-dihydroxypropyl]isoindole-1,3-dione |
| InChIKey | GUUVCKWUQHAMTB-SSDOTTSWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C[C@H](CO)O |
Computed by PubChem (NCBI)