CAS 62457-35-6 appears in our catalog under these names: Rivaroxaban Impurity 115, 1-(3,4,5,6-Tetrahydrophthalimido)-2,3-dihydroxypropane, >95% (HPLC), 2-(2,3-Dihydroxypropyl)isoindoline-1,3-dione, 99%, 99%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 250mg, 500mg, 5g, 1g.
2-(2,3-dihydroxypropyl)isoindole-1,3-dione (CAS 62457-35-6) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 2-(2,3-dihydroxypropyl)isoindole-1,3-dione. InChIKey: GUUVCKWUQHAMTB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-(2,3-dihydroxypropyl)isoindole-1,3-dione |
| InChIKey | GUUVCKWUQHAMTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(CO)O |
Computed by PubChem (NCBI)