CAS 186387-91-7 appears in our catalog under these names: 5-Chloro-2-(2,2,2-trifluoroethoxy)aniline, 95%, 5-Chloro-2-(2,2,2-trifluoroethoxy)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-chloro-2-(2,2,2-trifluoroethoxy)aniline (CAS 186387-91-7) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: 5-chloro-2-(2,2,2-trifluoroethoxy)aniline. InChIKey: QVHQVFPXAKZMKQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 5-chloro-2-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | QVHQVFPXAKZMKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)OCC(F)(F)F |
Computed by PubChem (NCBI)