CAS 1864003-22-4 is the registry number for Rac-(4ar,8as)-octahydropyrano[3,4-b][1,4]oxazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4aR,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]oxazine;hydrochloride (CAS 1864003-22-4) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (4aR,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]oxazine;hydrochloride. InChIKey: PRYVULQXGABNLD-LEUCUCNGSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (4aR,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]oxazine;hydrochloride |
| InChIKey | PRYVULQXGABNLD-LEUCUCNGSA-N |
| SMILES | C1COC[C@H]2[C@H]1NCCO2.Cl |
Computed by PubChem (NCBI)