Products 1864073-20-0
CAS 1864073-20-0 is the registry number for (1-(2-Phenylethyl)-1H-1,2,3-triazol-4-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1-(2-phenylethyl)triazol-4-yl]methanol;hydrochloride (CAS 1864073-20-0) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: [1-(2-phenylethyl)triazol-4-yl]methanol;hydrochloride. InChIKey: RMRYYNKDYACAMX-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | [1-(2-phenylethyl)triazol-4-yl]methanol;hydrochloride |
| InChIKey | RMRYYNKDYACAMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C=C(N=N2)CO.Cl |
Computed by PubChem (NCBI)