Products 1864073-67-5
CAS 1864073-67-5 appears in our catalog under these names: 2-Amino-4,6-dichloronicotinic acid, 97%, 2-Amino-4,6-dichloronicotinic acid, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-4,6-dichloropyridine-3-carboxylic acid (CAS 1864073-67-5) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2-amino-4,6-dichloropyridine-3-carboxylic acid. InChIKey: YWMSCKNECPYDLX-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2-amino-4,6-dichloropyridine-3-carboxylic acid |
| InChIKey | YWMSCKNECPYDLX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)N)C(=O)O)Cl |
Computed by PubChem (NCBI)