CAS 73255-51-3 appears in our catalog under these names: N-Acetyl-L-cysteine Isopropyl Este, N-Acetyl-L-cysteine Isopropyl Ester. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 100mg, 1g, 500mg, 25mg.
Propan-2-yl (2R)-2-acetamido-3-sulfanylpropanoate (CAS 73255-51-3) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: propan-2-yl (2R)-2-acetamido-3-sulfanylpropanoate. InChIKey: ZFGKNOCIAUGIIB-ZETCQYMHSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | propan-2-yl (2R)-2-acetamido-3-sulfanylpropanoate |
| InChIKey | ZFGKNOCIAUGIIB-ZETCQYMHSA-N |
| SMILES | CC(C)OC(=O)[C@H](CS)NC(=O)C |
Computed by PubChem (NCBI)