CAS 1864801-23-9 appears in our catalog under these names: 5-(Methoxycarbonyl)naphthalene-1-boronic acid pinacol ester, 98%, 5-(Methoxycarbonyl)naphthalene-1-boronic acid pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate (CAS 1864801-23-9) is a chemical compound with the molecular formula C18H21BO4 and a molecular weight of 312.2 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate. InChIKey: MMCCBODBDDLOIV-UHFFFAOYSA-N.
| Molecular formula | C18H21BO4 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate |
| InChIKey | MMCCBODBDDLOIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=C(C3=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)