CAS 3033274-74-4 is the registry number for Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-naphthoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate (CAS 3033274-74-4) is a chemical compound with the molecular formula C18H21BO4 and a molecular weight of 312.2 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate. InChIKey: XPMZPISIGOKGHY-UHFFFAOYSA-N.
| Molecular formula | C18H21BO4 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate |
| InChIKey | XPMZPISIGOKGHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC(=CC3=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)