CAS 736989-93-8 appears in our catalog under these names: 6-(Methoxycarbonyl)naphthalene-2-boronic acid pinacol ester, 95-<97%, 6-(Methoxycarbonyl)naphthalene-2-boronic acid pinacol ester, ≥97-<99%, 6–(Methoxycarbonyl)naphthalene–2–boronic acid pinacol ester, Methyl 6-(tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate, 2-Naphthalenecarboxylic acid, 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester, 98%, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 1g, 250mg.
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate (CAS 736989-93-8) is a chemical compound with the molecular formula C18H21BO4 and a molecular weight of 312.2 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate. InChIKey: WEDOOEMXFXWHAU-UHFFFAOYSA-N.
| Molecular formula | C18H21BO4 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylate |
| InChIKey | WEDOOEMXFXWHAU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)