CAS 2490666-18-5 is the registry number for Acetic acid 6-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-naphthalen-2-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] acetate (CAS 2490666-18-5) is a chemical compound with the molecular formula C18H21BO4 and a molecular weight of 312.2 g/mol. IUPAC name: [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] acetate. InChIKey: JZHMTATZPKPSTO-UHFFFAOYSA-N.
| Molecular formula | C18H21BO4 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | [6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl] acetate |
| InChIKey | JZHMTATZPKPSTO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(C=C3)OC(=O)C |
Computed by PubChem (NCBI)