CAS 919363-25-0 is the registry number for Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-naphthoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate (CAS 919363-25-0) is a chemical compound with the molecular formula C18H21BO4 and a molecular weight of 312.2 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate. InChIKey: LTXKCMSLPBJJJO-UHFFFAOYSA-N.
| Molecular formula | C18H21BO4 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate |
| InChIKey | LTXKCMSLPBJJJO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)