CAS 1865726-28-8 is the registry number for Lifitegrast Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-2-amino-3-(4-methylsulfonylphenyl)propanoate (CAS 1865726-28-8) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: benzyl (2S)-2-amino-3-(4-methylsulfonylphenyl)propanoate. InChIKey: UKIWRNOAQYPTME-INIZCTEOSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-(4-methylsulfonylphenyl)propanoate |
| InChIKey | UKIWRNOAQYPTME-INIZCTEOSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C[C@@H](C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)