CAS 1866371-14-3 is the registry number for 1-(2,6-Dichloropyrimidin-4-yl)piperidin-4-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2,6-dichloropyrimidin-4-yl)piperidin-4-ol (CAS 1866371-14-3) is a chemical compound with the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. IUPAC name: 1-(2,6-dichloropyrimidin-4-yl)piperidin-4-ol. InChIKey: FMHUATRTCKSPAM-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3O |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 1-(2,6-dichloropyrimidin-4-yl)piperidin-4-ol |
| InChIKey | FMHUATRTCKSPAM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)