Products 1955498-69-7
CAS 1955498-69-7 is the registry number for 2-(aminomethyl)-3,4-dihydroquinazolin-4-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-(aminomethyl)-3H-quinazolin-4-one;dihydrochloride (CAS 1955498-69-7) is a chemical compound with the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. IUPAC name: 2-(aminomethyl)-3H-quinazolin-4-one;dihydrochloride. InChIKey: JFITWZBSSYVVQN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3O |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 2-(aminomethyl)-3H-quinazolin-4-one;dihydrochloride |
| InChIKey | JFITWZBSSYVVQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)