CAS 1808378-40-6 is the registry number for 4-Amino-5-phenyl-2,3-dihydro-1H-pyrazol-3-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-amino-5-phenyl-1,2-dihydropyrazol-3-one;dihydrochloride (CAS 1808378-40-6) is a chemical compound with the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. IUPAC name: 4-amino-5-phenyl-1,2-dihydropyrazol-3-one;dihydrochloride. InChIKey: XVHFGCHEPKXZAV-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3O |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 4-amino-5-phenyl-1,2-dihydropyrazol-3-one;dihydrochloride |
| InChIKey | XVHFGCHEPKXZAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NN2)N.Cl.Cl |
Computed by PubChem (NCBI)