CAS 2068724-47-8 is the registry number for N-(3,6-Dichloropyridazin-4-yl)pivalamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,6-dichloropyridazin-4-yl)-2,2-dimethylpropanamide (CAS 2068724-47-8) is a chemical compound with the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. IUPAC name: N-(3,6-dichloropyridazin-4-yl)-2,2-dimethylpropanamide. InChIKey: TYRGLOQQFMEXPZ-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3O |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | N-(3,6-dichloropyridazin-4-yl)-2,2-dimethylpropanamide |
| InChIKey | TYRGLOQQFMEXPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=NN=C1Cl)Cl |
Computed by PubChem (NCBI)