CAS 1240035-01-1 is the registry number for (R)-4-(2,6-Dichloropyrimidin-4-yl)-3-methylmorpholine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-4-(2,6-dichloropyrimidin-4-yl)-3-methylmorpholine (CAS 1240035-01-1) is a chemical compound with the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. IUPAC name: (3R)-4-(2,6-dichloropyrimidin-4-yl)-3-methylmorpholine. InChIKey: VWYKHJBMWAKLPM-ZCFIWIBFSA-N.
| Molecular formula | C9H11Cl2N3O |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | (3R)-4-(2,6-dichloropyrimidin-4-yl)-3-methylmorpholine |
| InChIKey | VWYKHJBMWAKLPM-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1COCCN1C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)