CAS 1609400-00-1 appears in our catalog under these names: ([3-(2-Pyridinyl)-5-isoxazolyl]methyl)amine dihydrochloride, 95%, (3-(Pyridin-2-yl)isoxazol-5-yl)methanamine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
(3-pyridin-2-yl-1,2-oxazol-5-yl)methanamine;dihydrochloride (CAS 1609400-00-1) is a chemical compound with the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. IUPAC name: (3-pyridin-2-yl-1,2-oxazol-5-yl)methanamine;dihydrochloride. InChIKey: XXJBJYTYWQRRLJ-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3O |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | (3-pyridin-2-yl-1,2-oxazol-5-yl)methanamine;dihydrochloride |
| InChIKey | XXJBJYTYWQRRLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NOC(=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)