CAS 186801-05-8 is the registry number for Methyl (R)-2-amino-2-(4-methoxyphenyl)acetate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (2R)-2-amino-2-(4-methoxyphenyl)acetate;hydrochloride (CAS 186801-05-8) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-methoxyphenyl)acetate;hydrochloride. InChIKey: VUEACPSVBZTUCV-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-methoxyphenyl)acetate;hydrochloride |
| InChIKey | VUEACPSVBZTUCV-SBSPUUFOSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)