CAS 1869638-67-4 is the registry number for 2-{((tert-butoxy)carbonyl)amino}-3,4-dimethylpentanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1869638-67-4) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: 3,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: TZRZWXQCEBWGKY-UHFFFAOYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 3,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | TZRZWXQCEBWGKY-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)