Products 2549158-98-5
CAS 2549158-98-5 is the registry number for (2S)-2-((tert-Butoxycarbonyl)amino)-3,4-dimethylpentanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 2549158-98-5) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2S)-3,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: TZRZWXQCEBWGKY-GKAPJAKFSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2S)-3,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | TZRZWXQCEBWGKY-GKAPJAKFSA-N |
| SMILES | CC(C)C(C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)