CAS 187231-28-3 is the registry number for 8-Chlorocinnolin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chlorocinnolin-4-amine (CAS 187231-28-3) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 8-chlorocinnolin-4-amine. InChIKey: ZSSJMQUFNUKOAO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 8-chlorocinnolin-4-amine |
| InChIKey | ZSSJMQUFNUKOAO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=NC=C2N |
Computed by PubChem (NCBI)