Products 187235-13-8
CAS 187235-13-8 is the registry number for (R)-2-Nitro-6,7-dihydro-5h-imidazo[2,1-b][1,3]oxazin-6-ol, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(6R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-ol (CAS 187235-13-8) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: (6R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-ol. InChIKey: HMFPMGBWSFUHEN-SCSAIBSYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | (6R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-ol |
| InChIKey | HMFPMGBWSFUHEN-SCSAIBSYSA-N |
| SMILES | C1[C@H](COC2=NC(=CN21)[N+](=O)[O-])O |
Computed by PubChem (NCBI)