CAS 18735-74-5 appears in our catalog under these names: 2-Phenyl-5-methyloxazole-4-carboxylic Acid, 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid, 97% , 5-Methyl-2-phenyloxazole-4-carboxylic acid, ≥97%, ≥97%, 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid, ≥97%. Offered by: TRC, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 5g, 250MG, 1g, 100mg.
5-methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS 18735-74-5) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 5-methyl-2-phenyl-1,3-oxazole-4-carboxylic acid. InChIKey: YABCPNYCFFUVNM-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 5-methyl-2-phenyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | YABCPNYCFFUVNM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)