CAS 1877-66-3 appears in our catalog under these names: 3-(Methylsulfonyl)acetophenone, Etoricoxib Impurity 60. Offered by: Biosynth, Chemat Brand. Available pack sizes: 50mg, 0,5g, on request.
1-(3-methylsulfonylphenyl)ethanone (CAS 1877-66-3) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 1-(3-methylsulfonylphenyl)ethanone. InChIKey: KXBGSIFAYKVMKG-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 1-(3-methylsulfonylphenyl)ethanone |
| InChIKey | KXBGSIFAYKVMKG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)